| iupac name | (2R,6S,12Z,13aS,14aR,16aS)-N-(Cyclopropylsulfonyl)-6-{[(5-methyl-2-pyrazinyl)carbonyl]amino}-5,16-dioxo-2-(6-phenanthridinyloxy)-1,2,3,6,7,8,9,10,11,13a,14,15,16,16a-tetradecahydrocyclopropa[e]pyrrolo [1,2-a] [1,4]diazacyclopentadecine-14a(5H)-carboxamide |
|---|
| width | 285 |
|---|
| tradename | Viekira Pak (in combination with ombitasvir, ritonavir and dasabuvir), Technivie/Viekirax (in combination with ombitasvir and ritonavir) |
|---|
| pregnancy us | B |
|---|
| licence eu | yes |
|---|
| legal us | Rx-only |
|---|
| routes of administration | Oral |
|---|
| bioavailability | was not evaluated |
|---|
| protein bound | 97–98.6% |
|---|
| metabolism | Hepatic, CYP3A4 and CYP3A5 |
|---|
| onset | 4 to 5 hours |
|---|
| elimination half-life | 5.5 hours |
|---|
| excretion | feces (88%), urine (8,8%) |
|---|
| cas number | 1216941-48-8 |
|---|
| unii | OU2YM37K86 |
|---|
| atc prefix | J05 |
|---|
| atc suffix | AP52 |
|---|
| pubchem | 45110509 |
|---|
| chebi | 85188 |
|---|
| chembl | 3391662 |
|---|
| drugbank | DB09297 |
|---|
| chemspiderid | 32700634 |
|---|
| kegg | D10580 |
|---|
| synonyms | Veruprevir; ABT-450 |
|---|
| c | 40 |
|---|
| h | 43 |
|---|
| n | 7 |
|---|
| o | 7 |
|---|
| s | 1 |
|---|
| smiles | Cc1cnc(cn1)C(=O)N[C@H]2CCCCC/C=C\[C@@H]3C[C@]3(NC(=O)[C@@H]4C[C@H](CN4C2=O)Oc5c6ccccc6c7ccccc7n5)C(=O)NS(=O)(=O)C8CC8 |
|---|
| stdinchi | 1S/C40H43N7O7S/c1-24-21-42-33(22-41-24)35(48)43-32-16-6-4-2-3-5-11-25-20-40(25,39(51)46-55(52,53)27-17-18-27)45-36(49)34-19-26(23-47(34)38(32)50)54-37-30-14-8-7-12-28(30)29-13-9-10-15-31(29)44-37/h5,7-15,21-22,25-27,32,34H,2-4,6,16-20,23H2,1H3,(H,43,48)(H,45,49)(H,46,51)/b11-5-/t25-,26-,32+,34+,40-/m1/s1 |
|---|
| stdinchikey | UAUIUKWPKRJZJV-QPLHLKROSA-N |
|---|
| jmol | None |
|---|
